CAS 691007-09-7
:3-[2-[4-[C-(2,4-difluorophenyl)-N-hydroxy-carbonimidoyl]-1-piperidyl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
Description:
The chemical substance known as 3-[2-[4-[C-(2,4-difluorophenyl)-N-hydroxy-carbonimidoyl]-1-piperidyl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one, with the CAS number 691007-09-7, is a complex organic compound characterized by its multi-cyclic structure and the presence of various functional groups. It features a tetrahydropyrido-pyrimidinone core, which contributes to its potential biological activity. The presence of a piperidine ring and a difluorophenyl moiety suggests that it may interact with biological targets, possibly influencing pharmacological properties. The N-hydroxy-carbonimidoyl group indicates potential reactivity and may play a role in the compound's mechanism of action. Overall, this compound's intricate structure and functional groups suggest it may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activity, solubility, stability, and other physicochemical properties would require further investigation through experimental studies.
Formula:C23H28F2N4O2
InChI:InChI=1/C23H28F2N4O2/c1-15-18(23(30)29-10-3-2-4-21(29)26-15)9-13-28-11-7-16(8-12-28)22(27-31)19-6-5-17(24)14-20(19)25/h5-6,14,16,31H,2-4,7-13H2,1H3/b27-22+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Risperidone EP Impurity A
CAS:Formula:C23H28F2N4O2Color and Shape:White To Off-White SolidMolecular weight:430.50Risperidone E-oxime
CAS:Risperidone E-oxime: Risperidone impurity, 5-HT2 & dopamine D2 blocker (Ki: 4.8, 5.9 nM), P-Glycoprotein inhibitor.Formula:C23H28F2N4O2Purity:98%Color and Shape:SolidMolecular weight:430.493-[2-[4-[(E)-(2,4-Difluorophenyl)(hydroxyimino)methyl]piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one
CAS:Controlled ProductFormula:C23H28F2N4O2Color and Shape:NeatMolecular weight:430.49Risperidone E-Oxime Impurity
CAS:Controlled ProductFormula:C23H28F2N4O2Color and Shape:NeatMolecular weight:430.49Risperidone E-oxime impurity
CAS:Risperidone E-oxime impurity is a drug product that has been studied for its metabolism in humans, animals and plants. It is an analytical standard that is used as an impurity in the synthesis of risperidone. Risperidone E-oxime impurity is also a synthetic compound with CAS No. 691007-09-7. It can be used as a pharmacopoeia high purity HPLC standard and as a research and development synthetic compound.
Formula:C23H28F2N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:430.49 g/molRef: 3D-IR27738
Discontinued product





