CAS 69113-01-5

1,1,3-tris(2-chloroethyl)-3-nitrosourea

Description:

1,1,3-Tris(2-chloroethyl)-3-nitrosourea, with the CAS number 69113-01-5, is a synthetic organic compound that belongs to the class of nitrosoureas, which are known for their alkylating properties. This compound is characterized by the presence of three chloroethyl groups and a nitrosourea functional group, which contribute to its reactivity. It is typically a white to off-white solid and is soluble in organic solvents. Due to its structure, it exhibits potent antitumor activity and has been studied for its potential use in cancer chemotherapy. The mechanism of action involves the formation of DNA cross-links, which inhibit DNA replication and transcription, ultimately leading to cell death. However, like many nitrosoureas, it may also have significant toxicity and side effects, necessitating careful handling and usage in a controlled environment. Its stability and reactivity can be influenced by environmental conditions, making it important to store it properly to maintain its efficacy and safety.

Formula: C₇H₁₂Cl₃N₃O₂

InChI: InChI=1/C7H12Cl3N3O2/c8-1-4-12(5-2-9)7(14)13(11-15)6-3-10/h1-6H2

SMILES: C(CN(CCCl)C(=O)N(CCCl)N=O)Cl

Carmustine Impurity 1 (N-Nitroso Tris-(2-Chloroethyl) Urea)

CAS: 69113-01-5

Formula: C₇H₁₂Cl₃N₃O₂

Molecular weight: 276.54

Ref: 4Z-C-474004

N-Nitrosotris-(2-chloroethyl)urea (90%)

Controlled Product

CAS: 69113-01-5

Stability Unstable at Room Temperature
Applications N-Nitrosotris-(2-chloroethyl)urea 90% (cas# 69113-01-5) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Rehm, S., et al.: American Jounal of Pathology, 139, 2, 413 (1991), Wang, Y., et al.: Cancer Research, 64, 1647 (2004)

Formula: C₇H₁₂Cl₃N₃O₂

Purity: 90%

Color and Shape: Neat

Molecular weight: 276.55

Ref: TR-N547250