CAS 69113-98-0

ethyl (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate

Description:

Ethyl (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate, with the CAS number 69113-98-0, is an organic compound characterized by its ester functional group and a conjugated double bond system. This compound features a phenolic moiety with two methoxy groups at the 3 and 5 positions, contributing to its potential biological activity and solubility properties. The presence of the hydroxy group enhances its reactivity and may influence its interaction with biological targets. Ethyl (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate is likely to exhibit moderate polarity due to the combination of hydrophobic methoxy groups and the hydrophilic hydroxy group. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antioxidant or anti-inflammatory properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a unique structure with potential significance in medicinal chemistry and related fields.

Formula: C₁₃H₁₆O₅

InChI: InChI=1/C13H16O5/c1-4-18-12(14)6-5-9-7-10(16-2)13(15)11(8-9)17-3/h5-8,15H,4H2,1-3H3/b6-5+

Synonyms:

• 2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, ethyl ester

3,5-Dimethoxy-4-hydroxycinnamic acid ethyl ester

CAS: 69113-98-0

3,5-Dimethoxy-4-hydroxycinnamic acid ethyl ester is a redox potential with an acidic character. It can be synthesized from p-hydroxybenzoic acid and acetate extract of the plant Carthamus tinctorius. The synthesis starts with an asymmetric synthesis of protocatechuic acid and its derivatives. This compound is also found in the surface methodology of fatty acids and radiation that has been studied by nmr spectroscopic data. 3,5-Dimethoxy-4-hydroxycinnamic acid ethyl ester has bioactive phenolic properties and can be used for the treatment of various diseases such as cancer or diabetes.

Formula: C₁₃H₁₆O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 252.26 g/mol

Ref: 3D-FD67307

Ethyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate

CAS: 69113-98-0

Formula: C₁₃H₁₆O₅

Color and Shape: No data available.

Molecular weight: 252.266

Ref: 10-F099659