CAS 69123-93-9
:4-amino-5-bromo-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one
Description:
4-amino-5-bromo-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one is a nucleoside analog that exhibits characteristics typical of pyrimidine derivatives. This compound features a pyrimidine ring substituted with an amino group and a bromine atom, which can influence its biological activity and stability. The presence of the 2-deoxy-2-fluoro-beta-D-arabinofuranosyl moiety suggests that it may interact with nucleic acids, potentially inhibiting viral replication or acting as an antiviral agent. The fluorine substitution can enhance the compound's metabolic stability and alter its pharmacokinetic properties. This substance is of interest in medicinal chemistry, particularly in the development of antiviral therapies, due to its structural similarity to natural nucleosides. Its CAS number, 69123-93-9, allows for easy identification in chemical databases. Overall, this compound's unique structural features contribute to its potential applications in pharmaceutical research and development.
Formula:C9H11BrFN3O4
InChI:InChI=1/C9H11BrFN3O4/c10-3-1-14(9(17)13-7(3)12)8-5(11)6(16)4(2-15)18-8/h1,4-6,8,15-16H,2H2,(H2,12,13,17)/t4-,5+,6-,8-/m1/s1
Synonyms:- 1-(2-Deoxy-2-fluoro-Beta-D-arabinofuranosyl)-5-bromocytosine
- 2(1H)-Pyrimidinone, 4-amino-5-bromo-1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-
- 2'-fluoro-5-bromo-1-beta-D-arabinofuranosylcytosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Bromo-2'-deoxy-2'-fluoro-β-D-arabinocytidine
CAS:Halo-nucleoside; fluoro-modified nucleoside; arabino-nucleosideFormula:C9H11BrFN3O4Color and Shape:SolidMolecular weight:324.1
