CAS 69124-27-2
:4-hydroperoxy-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
Description:
4-Hydroperoxy-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one, with the CAS number 69124-27-2, is a chemical compound characterized by its unique pyrazolone structure, which includes a hydroperoxy functional group. This compound typically exhibits properties associated with both pyrazolones and hydroperoxides, such as potential reactivity and stability under specific conditions. It may serve as an intermediate in organic synthesis or as a reagent in various chemical reactions, particularly those involving radical mechanisms. The presence of the hydroperoxy group suggests that it could act as an oxidizing agent, while the dimethyl and phenyl substituents may influence its solubility and reactivity. Additionally, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry. However, due to the presence of reactive functional groups, handling precautions are necessary to mitigate risks associated with its reactivity and potential toxicity. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C11H12N2O3
InChI:InChI=1/C11H12N2O3/c1-8-10(16-15)11(14)13(12(8)2)9-6-4-3-5-7-9/h3-7,15H,1-2H3
SMILES:Cc1c(c(=O)n(c2ccccc2)n1C)OO
Synonyms:- 3H-Pyrazol-3-one, 1,2-dihydro-4-hydroperoxy-1,5-dimethyl-2-phenyl-
- 4-Hydroperoxy-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
