CAS 6913-92-4
:1-benzyl-3-pyrroline
Description:
1-Benzyl-3-pyrroline is an organic compound characterized by its unique structure, which features a pyrroline ring—a five-membered cyclic compound containing nitrogen—and a benzyl group attached to it. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. It is a colorless to pale yellow liquid at room temperature and is soluble in organic solvents. The presence of the benzyl group enhances its lipophilicity, making it more soluble in non-polar solvents. 1-Benzyl-3-pyrroline may participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, due to the electron-rich nature of the pyrroline nitrogen. Additionally, it has been studied for its potential applications in medicinal chemistry and as a building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H13N
InChI:InChI=1/C11H13N/c1-2-6-11(7-3-1)10-12-8-4-5-9-12/h1-7H,8-10H2
SMILES:c1ccc(cc1)CN1CC=CC1
Synonyms:- 1-Benzyl-2,5-dihydro-1H-pyrrole
- 1-(Phenylmethyl)-2,5-dihydropyrrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzyl-3-pyrroline, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H13NPurity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:159.231-Benzyl-2,5-dihydro-1H-pyrrole
CAS:Formula:C11H13NPurity:97%Color and Shape:LiquidMolecular weight:159.22761-Benzyl-2,5-dihydropyrrole
CAS:<p>1-Benzyl-2,5-dihydropyrrole</p>Purity:95%Molecular weight:159.23g/mol
