CymitQuimica logo

CAS 69134-42-5

:

2-(4-chlorophenyl)-1-phenylethanamine hydrochloride

Description:
2-(4-Chlorophenyl)-1-phenylethanamine hydrochloride, with the CAS number 69134-42-5, is a chemical compound that belongs to the class of phenethylamines. It features a phenyl group and a 4-chlorophenyl substituent on the ethylamine backbone, which contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in research and pharmaceuticals. It exhibits characteristics such as being a white to off-white crystalline solid, with a relatively stable structure under standard conditions. The presence of the chlorine atom on the aromatic ring can influence its biological activity and interaction with receptors. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions are essential, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in medicinal chemistry and pharmacological studies, particularly in the context of its potential therapeutic effects.
Formula:C14H15Cl2N
InChI:InChI=1/C14H14ClN.ClH/c15-13-8-6-11(7-9-13)10-14(16)12-4-2-1-3-5-12;/h1-9,14H,10,16H2;1H
SMILES:c1ccc(cc1)C(Cc1ccc(cc1)Cl)N.Cl
Found 0 products.