CAS 691381-10-9

1-[(5-bromo-2-methoxyphenyl)sulfonyl]pyrrolidine

Description:

1-[(5-bromo-2-methoxyphenyl)sulfonyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a sulfonyl group attached to a substituted phenyl moiety. The presence of a bromine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the sulfonyl group, which can enhance its solubility in polar solvents. The bromine substituent may also influence its electronic properties, potentially affecting its interactions in biological systems. As a sulfonamide derivative, it may possess pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 1-[(5-bromo-2-methoxyphenyl)sulfonyl]pyrrolidine is a complex organic molecule with potential applications in research and development within the fields of pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₄BrNO₃S

InChI: InChI=1/C11H14BrNO3S/c1-16-10-5-4-9(12)8-11(10)17(14,15)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3

SMILES: COc1ccc(cc1S(=O)(=O)N1CCCC1)Br

Synonyms:

• Pyrrolidine, 1-[(5-Bromo-2-Methoxyphenyl)Sulfonyl]-

1-(5-Bromo-2-methoxyphenylsulfonyl)pyrrolidine

CAS: 691381-10-9

Formula: C₁₁H₁₄BrNO₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 320.2028

Ref: IN-DA003D1C

4-Bromo-2-(pyrrolidin-1-ylsulphonyl)anisole

CAS: 691381-10-9

4-Bromo-2-(pyrrolidin-1-ylsulphonyl)anisole

Purity: 97%

Molecular weight: 320.20g/mol

Ref: 54-OR9407

1-(5-Bromo-2-methoxyphenylsulfonyl)pyrrolidine

CAS: 691381-10-9

Purity: 97%

Molecular weight: 320.2000122

Ref: 10-F638302