CAS 6914-76-7
:1-Methylcyclopropanecarboxylic acid
Description:
1-Methylcyclopropanecarboxylic acid, with the CAS number 6914-76-7, is an organic compound characterized by its cyclopropane ring structure, which is substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive odor. It is soluble in organic solvents and has limited solubility in water due to the hydrophobic nature of the cyclopropane ring. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its unique structure makes it of interest in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the compound's reactivity can be influenced by the strain inherent in the cyclopropane ring, which can lead to interesting chemical behavior under certain conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H8O2
InChI:InChI=1/C5H8O2/c1-5(2-3-5)4(6)7/h2-3H2,1H3,(H,6,7)
InChI key:InChIKey=DIZKLZKLNKQFGB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C)CC1
Synonyms:- 1-Methylcyclopropan-1-carboxylic acid
- 1-Methylcyclopropane-1-carboxylic acid
- 1-Methylcyclopropanoic acid
- Cyclopropanecarboxylic acid, 1-methyl-
- 1-Methylcyclopropanecarboxylic acid
- 1-Methylcyclopropancarbonsure
- 1-Methylcyclopropanecarboxylic acid 98%
- Einecs 230-020-7
- 1-Carboxy-1-methylcyclopropane
- 1-methyl cyclopropyl carboxylic acid
- 1-Methylcyclopropane-1-carboxylicAcid>
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Methylcyclopropane-1-carboxylic Acid
CAS:Formula:C5H8O2Purity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow powder to lump to clear liquidMolecular weight:100.121-Methylcyclopropanecarboxylic acid
CAS:Formula:C5H8O2Purity:97.0%Color and Shape:LiquidMolecular weight:100.1171-Methylcyclopropane-1-carboxylic acid
CAS:Formula:C5H8O2Purity:97%Color and Shape:SolidMolecular weight:100.1158Ref: IN-DA0036SF
1g25.00€5g52.00€10g79.00€25g147.00€50gTo inquire100g356.00€250gTo inquire500gTo inquire250mg20.00€1-Methylcyclopropane-1-carboxylic acid
CAS:1-Methylcyclopropane-1-carboxylic acidFormula:C5H8O2Purity:95%Color and Shape: white solidMolecular weight:100.12g/mol1-Methylcyclopropane-1-carboxylic acid
CAS:1-Methylcyclopropane-1-carboxylic acid is a reactive, stereoisomeric amide with an alkaline metal. It can be prepared by the reaction of methoxide and nitrobenzene in the presence of a base such as potassium hydroxide. 1-Methylcyclopropane-1-carboxylic acid has been shown to have potent antitumor activity against solid tumors in vivo. This compound was also shown to inhibit the growth of human prostate cancer cells in vitro. Additionally, 1-methylcyclopropane-1-carboxylic acid has been shown to inhibit the generation of reactive oxygen species (ROS) from xylene and other aromatic hydrocarbons, which may be due to its ability to nitrosylate these compounds and prevent them from reacting with oxygen.Formula:C5H8O2Purity:Min. 95%Molecular weight:100.12 g/mol




