CAS 6914-90-5
:1-Methylethyl hydrogen sulfate
Description:
1-Methylethyl hydrogen sulfate, also known as isopropyl hydrogen sulfate, is an organosulfur compound characterized by its sulfate functional group. It is typically a colorless to pale yellow liquid with a pungent odor. This compound is soluble in water and polar organic solvents, making it useful in various chemical reactions. It is primarily utilized as an alkylating agent in organic synthesis, particularly in the production of isopropyl derivatives. The presence of the hydrogen sulfate group imparts acidic properties, allowing it to act as a proton donor in reactions. Additionally, 1-methylethyl hydrogen sulfate can be corrosive and should be handled with care, as it may cause irritation to the skin, eyes, and respiratory tract. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance. Its reactivity and ability to form esters make it a valuable intermediate in the synthesis of various chemical compounds.
Formula:C3H8O4S
InChI:InChI=1S/C3H8O4S/c1-3(2)7-8(4,5)6/h3H,1-2H3,(H,4,5,6)
InChI key:InChIKey=IVNFTPCOZIGNAE-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C(C)C
Synonyms:- 1-Methylethyl hydrogen sulfate
- Isopropyl sulfate ((C<sub>3</sub>H<sub>7</sub>O)(HO)SO<sub>2</sub>)
- Monoisopropyl sulfate
- Propan-2-Yl Hydrogen Sulfate
- Rain-X
- Sulfuric acid, mono(1-methylethyl) ester
- Sulfuric acid, monoisopropyl ester
- Isopropyl sulfate ((C3H7O)(HO)SO2)
- Isopropyl hydrogen sulphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
