CAS 69152-89-2
:(8E)-10-Oxo-8-decenoic acid
Description:
(8E)-10-Oxo-8-decenoic acid, with the CAS number 69152-89-2, is a fatty acid characterized by its long carbon chain and a double bond in the trans configuration at the eighth carbon position. This compound features a ketone functional group at the tenth carbon, which contributes to its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents, but has limited solubility in water due to its hydrophobic nature. The presence of the double bond and the ketone group can influence its physical properties, such as melting and boiling points, as well as its behavior in chemical reactions. This compound may be of interest in various fields, including biochemistry and materials science, due to its potential applications in the synthesis of bioactive molecules or as a precursor in organic synthesis. Its specific characteristics, such as stability and reactivity, can vary depending on environmental conditions and the presence of other chemical species.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h5,7,9H,1-4,6,8H2,(H,12,13)/b7-5+
InChI key:InChIKey=YUAQBOMIASXPQW-FNORWQNLSA-N
SMILES:C(CC/C=C/C=O)CCCC(O)=O
Synonyms:- (8E)-10-Oxo-8-decenoic acid
- 8-Decenoic acid, 10-oxo-, (E)-
- 8-Decenoic acid, 10-oxo-, (8E)-
- 10-Oxo-trans-8-decenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
10-Oxo-trans-8-decenoic Acid
CAS:Controlled ProductApplications 10-Oxo-trans-8-decenoic Acid was found to be the major nonvolatile metabolite associated with the enzymic cleavage of linoleic acid to 1-octen-3-ol by mycelial homogenate of mushrooms.
References Tressl, R., et al.: J. Agri. Food Chem., 30, 89 (1982); Assaf, S., et al.: Enzyme Microb. Technol., 21, 484 (1997)Formula:C10H16O3Color and Shape:NeatMolecular weight:184.23210-Oxo-trans-8-decenoic acid
CAS:10-Oxo-trans-8-decenoic acid is a potent inhibitor that has been found to have anticancer properties. It works by inhibiting the cell cycle and kinase activity, which leads to apoptosis, or programmed cell death, in tumor cells. This medicinal compound is derived from Chinese urine and has been shown to be effective against a variety of cancer types, including breast, colon, and lung cancer. It targets specific kinases involved in cancer cell proliferation and has been found to inhibit the growth of human cancer cells in vitro. 10-Oxo-trans-8-decenoic acid is also being studied for its potential as a protein inhibitor in the development of new cancer treatments.Formula:C10H16O3Purity:Min. 95%Molecular weight:184.23 g/mol

