CAS 69168-09-8
:2-{2-[(4S)-4-amino-4-carboxybutanoyl]hydrazinyl}benzoic acid (non-preferred name)
Description:
2-{2-[(4S)-4-amino-4-carboxybutanoyl]hydrazinyl}benzoic acid, with the CAS number 69168-09-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a hydrazine derivative. This compound features an amino acid side chain, specifically a 4-amino-4-carboxybutanoic acid, which contributes to its potential biological activity. The presence of both hydrazine and carboxylic acid functional groups suggests that it may participate in various chemical reactions, including those typical of amino acids and hydrazines, such as condensation and redox reactions. The stereochemistry indicated by the (4S) designation implies that the compound has a specific three-dimensional arrangement, which can influence its reactivity and interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its potential to interact with biological targets. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C12H15N3O5
InChI:InChI=1/C12H15N3O5/c13-8(12(19)20)5-6-10(16)15-14-9-4-2-1-3-7(9)11(17)18/h1-4,8,14H,5-6,13H2,(H,15,16)(H,17,18)(H,19,20)/t8-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Anthglutin
CAS:<p>Anthglutin is a reversible glutamyl transpeptidase inhibitor.</p>Formula:C12H15N3O5Color and Shape:SolidMolecular weight:281.26
