CAS 69171-62-6

4-{[tert-butyl(dimethyl)silyl]oxy}butanoic acid

Description:

4-{[tert-butyl(dimethyl)silyl]oxy}butanoic acid, identified by its CAS number 69171-62-6, is an organic compound characterized by the presence of a butanoic acid moiety and a tert-butyl(dimethyl)silyl ether functional group. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of the silyl group and the carboxylic acid functional group, respectively. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The tert-butyl group contributes to its steric bulk, which can influence its reactivity and solubility in various solvents. This compound may be utilized in organic synthesis, particularly in the field of medicinal chemistry or materials science, where silyl protecting groups are often employed to enhance the stability and reactivity of functional groups during chemical reactions. Its unique structure allows for potential applications in drug development and as an intermediate in the synthesis of more complex molecules.

Formula: C₁₀H₂₂O₃Si

InChI: InChI=1/C10H22O3Si/c1-10(2,3)14(4,5)13-8-6-7-9(11)12/h6-8H2,1-5H3,(H,11,12)

SMILES: CC(C)(C)[Si](C)(C)OCCCC(=O)O

4-[(tert-Butyldimethylsilyl)oxy]butanoic acid

CAS: 69171-62-6

Versatile small molecule scaffold

Formula: C₁₀H₂₂O₃Si

Purity: Min. 95%

Molecular weight: 218.36 g/mol

Ref: 3D-UCA17162