CAS 69181-26-6
:5-Carboxymethylaminomethyluridine
Description:
5-Carboxymethylaminomethyluridine is a modified nucleoside that features a uridine base with a carboxymethylaminomethyl substituent at the 5-position. This compound is notable for its role in various biochemical processes, particularly in the context of RNA biology and potential therapeutic applications. The presence of the carboxymethyl group enhances its solubility and may influence its interaction with other biomolecules. As a nucleoside derivative, it retains the characteristic ribose sugar and uracil base, which are essential for its function in nucleic acid structures. The compound is of interest in research related to nucleic acid modifications, and its unique structure may provide insights into the regulation of gene expression and the development of novel RNA-based therapeutics. Additionally, its CAS number, 69181-26-6, allows for precise identification in chemical databases, facilitating further studies and applications in medicinal chemistry and molecular biology.
Formula:C12H17N3O8
InChI:InChI=1/C12H17N3O8/c16-4-6-8(19)9(20)11(23-6)15-3-5(1-13-2-7(17)18)10(21)14-12(15)22/h3,6,8-9,11,13,16,19-20H,1-2,4H2,(H,17,18)(H,14,21,22)/t6-,8-,9-,11-/m1/s1
InChI key:InChIKey=VSCNRXVDHRNJOA-PNHWDRBUSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C=C(CNCC(O)=O)C(=O)NC2=O
Synonyms:- 5-Carboxymethylaminomethyluridine
- Glycine, N-[(1,2,3,4-tetrahydro-2,4-dioxo-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-5-pyrimidinyl)methyl]-
- N-[(1,2,3,4-Tetrahydro-2,4-dioxo-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-5-pyrimidinyl)methyl]glycine
- Uridine, 5-[[(Carboxymethyl)Amino]Methyl]-
- [({1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl}methyl)amino]acetic acid (non-preferred name)
- Glycine, N-[(1,2,3,4-tetrahydro-2,4-dioxo-1-β-D-ribofuranosyl-5-pyrimidinyl)methyl]-
- N-[(1,2,3,4-Tetrahydro-2,4-dioxo-1-β-D-ribofuranosyl-5-pyrimidinyl)methyl]glycine
- Uridine-5-methylamino acetic acid
- 5-(((carboxymethyl)amino)methyl)uridine
- Uridine-5-methylamino acetic acid RNA-modified nucleoside cmnm5U
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Uridine-5-methylamino acetic acid
CAS:Uridine-5-methylamino acetic acidPurity:≥95%Molecular weight:331.28g/molUridine-5-methylamino acetic acid
CAS:Uridine-5-methylamino acetic acid(CMAMU) is a derivative of glycine and uracil, commonly used to study the synthesis and translation processes of nucleic acids.Formula:C12H17N3O8Color and Shape:SolidMolecular weight:331.285-Carboxymethylaminomethyluridine
CAS:5-Carboxymethylaminomethyluridine is a nucleoside analogue that is used in molecular modeling studies to investigate the role and interactions of uridine in the mitochondrial ribosome. It has been shown to bind to the mitochondrial ribosome, which may be due to hydrogen bonding interactions with adenine. 5-Carboxymethylaminomethyluridine also inhibits protein synthesis at the level of translation by inhibiting group P2 of eukaryotic cytosolic ribosomes. This inhibition results in decreased production of proteins necessary for mitochondrial biogenesis.Formula:C12H17N3O8Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:331.28 g/mol5-Carboxymethylaminomethyluridine
CAS:Controlled ProductFormula:C12H17N3O8Color and Shape:NeatMolecular weight:331.279




