CAS 69214-19-3

6-Chloro-3-phenyl-2-pyridinamine

Description:

6-Chloro-3-phenyl-2-pyridinamine, with the CAS number 69214-19-3, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a chloro substituent at the 6-position and a phenyl group at the 3-position of the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group (-NH2) allows for potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the chloro and phenyl groups can influence its electronic properties and reactivity, making it of interest in medicinal chemistry and material science. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Chloro-3-phenyl-2-pyridinamine is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₉ClN₂

InChI: InChI=1S/C11H9ClN2/c12-10-7-6-9(11(13)14-10)8-4-2-1-3-5-8/h1-7H,(H2,13,14)

InChI key: InChIKey=NOGZPCDWPPVALQ-UHFFFAOYSA-N

SMILES: NC1=C(C2=CC=CC=C2)C=CC(Cl)=N1

Synonyms:

• 2-Amino-6-chloro-3-phenylpyridine
• 6-Chloro-3-Phenylpyridin-2-Amine
• 6-Chloro-3-phenyl-2-pyridinamine
• 2-Pyridinamine, 6-chloro-3-phenyl-