CAS 692267-55-3

2-chloro-5-ethoxy-4-(propan-2-yloxy)benzaldehyde

Description:

2-Chloro-5-ethoxy-4-(propan-2-yloxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of a chloro substituent at the 2-position and an ethoxy group at the 5-position, along with a propan-2-yloxy group at the 4-position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both ether and aldehyde functional groups, which can influence its solubility in various solvents. The chloro group may also impart some reactivity, making it a potential candidate for further chemical transformations. Additionally, the ethoxy and propan-2-yloxy groups can affect the compound's steric hindrance and electronic properties, which may be relevant in applications such as synthesis or as an intermediate in organic reactions. Overall, 2-chloro-5-ethoxy-4-(propan-2-yloxy)benzaldehyde is a complex molecule with potential utility in various chemical contexts, including pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₅ClO₃

InChI: InChI=1/C12H15ClO3/c1-4-15-11-5-9(7-14)10(13)6-12(11)16-8(2)3/h5-8H,4H2,1-3H3

SMILES: CCOc1cc(C=O)c(cc1OC(C)C)Cl

Synonyms:

• 2-Chloro-5-ethoxy-4-isopropoxybenzaldehyde
• Benzaldehyde, 2-Chloro-5-Ethoxy-4-(1-Methylethoxy)-

2-chloro-5-ethoxy-4-isopropoxybenzaldehyde

CAS: 692267-55-3

Formula: C₁₂H₁₅ClO₃

Purity: 95.0%

Molecular weight: 242.7

Ref: 10-F315461

2-Chloro-5-ethoxy-4-isopropoxybenzaldehyde

CAS: 692267-55-3

Versatile small molecule scaffold

Formula: C₁₂H₁₅ClO₃

Purity: Min. 95%

Molecular weight: 242.7 g/mol

Ref: 3D-SCB26755