CAS 69227-51-6
:N-Ethyl-N-methylpyrrolidinium bromide
Description:
N-Ethyl-N-methylpyrrolidinium bromide is an ionic liquid characterized by its unique structure, which consists of a pyrrolidinium cation and a bromide anion. This compound typically exhibits a low melting point, often remaining liquid at room temperature, which is a hallmark of ionic liquids. Its cation, N-ethyl-N-methylpyrrolidinium, contributes to its stability and solubility in various solvents. The bromide anion enhances its ionic conductivity, making it suitable for applications in electrochemistry and as a solvent for chemical reactions. N-Ethyl-N-methylpyrrolidinium bromide is known for its thermal stability and low volatility, which are advantageous for processes requiring high temperatures or prolonged exposure to air. Additionally, it is often explored for its potential use in green chemistry due to its reduced environmental impact compared to traditional organic solvents. Its properties can be influenced by variations in the alkyl chain length or the anion, allowing for tailored applications in fields such as catalysis, extraction, and energy storage.
Formula:C7H16N·Br
InChI:InChI=1S/C7H16N.BrH/c1-3-8(2)6-4-5-7-8;/h3-7H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=KHJQQUGSPDBDRM-UHFFFAOYSA-M
SMILES:C(C)[N+]1(C)CCCC1.[Br-]
Synonyms:- 1-Methyl-1-ethylpyrrolidinium bromide
- N-Ethyl-N-methylpyrrolidinium bromide
- Pyrrolidinium, 1-ethyl-1-methyl-, bromide
- Pyrrolidinium, 1-ethyl-1-methyl-, bromide (1:1)
- 1-Ethyl-1-methylpyrrolidinium bromide
- 1-Ethyl-1-methylpyrrolidin-1-ium bromide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Ethyl-1-methylpyrrolidinium Bromide
CAS:Formula:C7H16BrNPurity:>97.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:194.121-Ethyl-1-methylpyrrolidinium bromide, 98%
CAS:1-Ethyl-1-methylpyrrolidinium bromide s an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informationFormula:C7H16BrNPurity:98%Molecular weight:194.121-Ethyl-1-Methylpyrrolidinium Bromide
CAS:Formula:C7H16BrNPurity:97%Color and Shape:SolidMolecular weight:194.11261-Ethyl-1-methylpyrrolidin-1-ium bromide
CAS:1-Ethyl-1-methylpyrrolidin-1-ium bromideFormula:C7H16BrNPurity:>98%Color and Shape:SolidMolecular weight:194.1161-Ethyl-1-methylpyrrolidin-1-ium bromide
CAS:1-Ethyl-1-methylpyrrolidin-1-ium bromideFormula:C7H16BrNPurity:97%Molecular weight:194.11





