CAS 692275-82-4

4-[2-(Acetyloxy)ethoxy]-3-methoxybenzaldehyde

Description:

4-[2-(Acetyloxy)ethoxy]-3-methoxybenzaldehyde, with the CAS number 692275-82-4, is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with both methoxy and acetyloxy groups. This compound typically exhibits properties associated with aromatic aldehydes, such as a distinct aromatic odor and potential reactivity in electrophilic aromatic substitution reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions. Additionally, the acetyloxy group can participate in esterification and hydrolysis reactions, contributing to its reactivity profile. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 4-[2-(Acetyloxy)ethoxy]-3-methoxybenzaldehyde is a versatile compound with potential applications in organic synthesis and pharmaceuticals.

Formula: C₁₂H₁₄O₅

InChI: InChI=1S/C12H14O5/c1-9(14)16-5-6-17-11-4-3-10(8-13)7-12(11)15-2/h3-4,7-8H,5-6H2,1-2H3

InChI key: InChIKey=PERBZSCRIFTMMD-UHFFFAOYSA-N

SMILES: O(CCOC(C)=O)C1=C(OC)C=C(C=O)C=C1

Synonyms:

• 4-(2-Acetoxyethoxy)-3-methoxybenzaldehyde
• 4-[2-(Acetyloxy)ethoxy]-3-methoxybenzaldehyde
• Benzaldehyde, 4-[2-(Acetyloxy)Ethoxy]-3-Methoxy-
• 2-(4-Formyl-2-methoxyphenoxy)ethyl acetate

2-(4-formyl-2-methoxyphenoxy)ethyl acetate

CAS: 692275-82-4

Formula: C₁₂H₁₄O₅

Purity: 95.0%

Molecular weight: 238.239

Ref: 10-F315470