CAS 692276-02-1

1-(4-Methylphenyl)-3-(phenylmethyl)-2-thioxo-4-imidazolidinone

Description:

1-(4-Methylphenyl)-3-(phenylmethyl)-2-thioxo-4-imidazolidinone, identified by its CAS number 692276-02-1, is a chemical compound that belongs to the class of imidazolidinones. This compound features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of both 4-methylphenyl and phenylmethyl substituents indicates that it has a complex aromatic structure, which may influence its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The thioxo group can enhance the compound's ability to participate in nucleophilic reactions, potentially leading to diverse applications in drug development. Additionally, the imidazolidinone core structure is often associated with a range of biological activities, including antimicrobial and anti-inflammatory effects. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination. Overall, this compound represents a unique structure with potential implications in pharmaceutical research.

Formula: C₁₇H₁₆N₂OS

InChI: InChI=1S/C17H16N2OS/c1-13-7-9-15(10-8-13)18-12-16(20)19(17(18)21)11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3

InChI key: InChIKey=GYBIMYXHRURYEE-UHFFFAOYSA-N

SMILES: S=C1N(CC(=O)N1CC2=CC=CC=C2)C3=CC=C(C)C=C3

Synonyms:

• 3-Benzyl-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-one
• 1-(4-Methylphenyl)-3-(phenylmethyl)-2-thioxo-4-imidazolidinone
• 3-Benzyl-1-(4-methylphenyl)-2-thioxoimidazolidin-4-one
• 4-Imidazolidinone, 1-(4-methylphenyl)-3-(phenylmethyl)-2-thioxo-