CAS 692288-06-5
:Ethyl (1R,2R)-2-iodocyclopropanecarboxylate
Description:
Ethyl (1R,2R)-2-iodocyclopropanecarboxylate is a chemical compound characterized by its unique cyclopropane structure, which contributes to its reactivity and potential applications in organic synthesis. The compound features an ethyl ester functional group, which enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions. The presence of the iodine atom at the 2-position of the cyclopropane ring introduces a halogen, making it a potential electrophile in nucleophilic substitution reactions. The (1R,2R) stereochemistry indicates that the compound has specific spatial arrangements of its atoms, which can affect its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry and synthetic organic chemistry due to its structural features, which can be utilized in the development of new pharmaceuticals or as intermediates in complex organic syntheses. As with many halogenated compounds, safety precautions should be taken when handling it, considering potential toxicity and environmental impact.
Formula:C6H9IO2
InChI:InChI=1S/C6H9IO2/c1-2-9-6(8)4-3-5(4)7/h4-5H,2-3H2,1H3/t4-,5+/m0/s1
InChI key:InChIKey=DWVNSRMOGUQGHD-CRCLSJGQSA-N
SMILES:C(OCC)(=O)[C@@H]1[C@H](I)C1
Synonyms:- Ethyl (1R,2R)-2-iodocyclopropanecarboxylate
- Cyclopropanecarboxylic acid, 2-iodo-, ethyl ester, (1R,2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
