CAS 6923-01-9

Imidazole-d4,98 atom %D

Description:

Imidazole-d4,98 atom %D is a deuterated form of imidazole, a five-membered heterocyclic compound containing two nitrogen atoms in the ring. The "d4" indicates that four hydrogen atoms in the imidazole structure have been replaced with deuterium, a stable isotope of hydrogen, which enhances its utility in various analytical techniques, particularly in NMR spectroscopy. This isotopic substitution can improve the resolution of spectral data and reduce background noise, making it valuable in studies of molecular dynamics and interactions. Imidazole itself is known for its role in biological systems, particularly as a component of amino acids like histidine and as a ligand in coordination chemistry. The presence of deuterium can also influence the physical and chemical properties of the compound, such as solubility and reactivity. Imidazole-d4 is often used in research settings, including drug development and biochemical studies, due to its ability to mimic the behavior of its non-deuterated counterpart while providing distinct advantages in analytical applications.

Formula: C₃D₄N₂

InChI: InChI=1/C3H4N2/c1-2-5-3-4-1/h1-3H,(H,4,5)/i1D,2D,3D/hD

SMILES: c1(c(n(c(n1)[2H])[2H])[2H])[2H]

Synonyms:

• Imidazole-d4
• (2H4)-1H-imidazole

Imidazole-d4

CAS: 6923-01-9

Imidazole-d4

Purity: 98%

Molecular weight: 72.1g/mol

Ref: 54-DE2197

Imidazole-d4

CAS: 6923-01-9

Imidazole-d4 is an isotope-labeled variant of imidazole, which is a heterocyclic aromatic compound. Imidazole molecules serve as inhibitors for acetylcholinesterase (AChEI) and xanthine oxidase (XO) and have been utilized as corrosion inhibitors. They display a range of biological activities, including antifungal, antitubercular, anti-inflammatory, antioxidant, and analgesic properties. Imidazole inhibits platelet microsomes from converting endoperoxides (PGG2 and PGH2) into thromboxane A2. Additionally, imidazole derivatives show inhibitory effects on the SARS-CoV-2 3CLpro enzyme, offering potential for research in Alzheimer’s disease, gout, COVID-19, and thrombotic disorders.

Formula: C₃H₄N₂

Color and Shape: Solid

Molecular weight: 72.1

Ref: TM-T203705

Imidazole-d4

CAS: 6923-01-9

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 72.10

Ref: 3U-D0961

Imidazole-d4

CAS: 6923-01-9

Formula: C₃D₄N₂

Molecular weight: 72.10

Ref: 4Z-I-078043