CymitQuimica logo

CAS 69243-07-8

:

2-[2-amino-4-(trifluoromethyl)thiazol-5-yl]ethanol

Description:
2-[2-amino-4-(trifluoromethyl)thiazol-5-yl]ethanol, with the CAS number 69243-07-8, is a chemical compound characterized by its thiazole ring structure, which incorporates a trifluoromethyl group and an amino group. This compound typically exhibits properties associated with both amines and alcohols, such as potential hydrogen bonding due to the hydroxyl (-OH) group and basicity from the amino (-NH2) group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The thiazole moiety contributes to its stability and reactivity, often participating in various chemical reactions. This compound may be utilized in pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. Its solubility characteristics can vary depending on the solvent, and it may exhibit specific interactions with biological macromolecules, which could be relevant for its function in biological systems. Overall, 2-[2-amino-4-(trifluoromethyl)thiazol-5-yl]ethanol is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C6H7F3N2OS
InChI:InChI=1/C6H7F3N2OS/c7-6(8,9)4-3(1-2-12)13-5(10)11-4/h12H,1-2H2,(H2,10,11)
SMILES:C(CO)c1c(C(F)(F)F)[nH]c(=N)s1
Synonyms:
  • 2-[2-Amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]ethanol
  • 5-Thiazoleethanol, 2-Amino-4-(Trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.