CAS 69243-49-8

[1,2,4]triazolo[3,4-b][1,3]benzothiazol-5-ylmethanol

Description:

[1,2,4]Triazolo[3,4-b][1,3]benzothiazol-5-ylmethanol is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a benzothiazole moiety. This compound typically exhibits properties associated with both triazoles and benzothiazoles, such as potential biological activity, including antimicrobial and anticancer properties. The presence of the hydroxymethyl group (-CH2OH) at the 5-position of the benzothiazole enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. The compound may also display interesting photophysical properties due to its conjugated system, which can be useful in the development of fluorescent probes or sensors. Additionally, its unique structure allows for potential interactions with biological targets, making it a subject of interest in drug discovery and development. As with many heterocycles, the stability and reactivity of this compound can be influenced by the electronic and steric effects of its substituents.

Formula: C₉H₇N₃OS

InChI: InChI=1/C9H7N3OS/c13-4-6-2-1-3-7-8(6)12-5-10-11-9(12)14-7/h1-3,5,13H,4H2

SMILES: c1cc(CO)c2c(c1)sc1nncn21

Synonyms:

• 1,2,4-Triazolo(3,4-b)benzothiazole-5-methanol

1,2,4-Triazolo[3,4-b]benzothiazole-5-methanol

CAS: 69243-49-8

Applications 1,2,4-Triazolo[3,4-b]benzothiazole-5-methanol is the major alcohol metabolite of tricyclazole (T291465) which is an common active ingredient in several commercial fungicide products used to control rice blast fungus, in transplanted and direct-seeded rice.
References Koons, J., et al.: J. Agri. Food Chem., 33, 552 (1985)

Formula: C₉H₇N₃OS

Color and Shape: Neat

Molecular weight: 205.24

Ref: TR-T767370