CymitQuimica logo

CAS 69249-61-2

:

2-Bromo-3-hexylthiophene

Description:
2-Bromo-3-hexylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the second position and a hexyl group at the third position of the thiophene ring contributes to its unique chemical properties. This compound is typically a liquid or solid at room temperature, depending on its purity and specific structural conformation. It exhibits notable solubility in organic solvents, making it useful in various applications, including organic electronics and materials science. The bromine substituent can participate in electrophilic substitution reactions, while the hexyl group enhances its solubility and hydrophobic characteristics. Additionally, 2-Bromo-3-hexylthiophene may exhibit interesting electronic properties, making it a candidate for use in organic semiconductors and photovoltaic devices. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound is of interest in both synthetic organic chemistry and materials science due to its functional properties.
Formula:C10H15BrS
InChI:InChI=1/C10H15BrS/c1-2-3-4-5-6-9-7-8-12-10(9)11/h7-8H,2-6H2,1H3
InChI key:XQJNXCHDODCAJF-UHFFFAOYSA-N
SMILES:CCCCCCc1ccsc1Br
Synonyms:
  • Thiophene, 2-Bromo-3-Hexyl-
  • K0282
Found 6 products.