![1,2,3-trimethoxychromeno[5,4,3-cde][1,3]dioxolo[4,5-h]chromene-5,11-dione](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F46831-123-trimethoxychromeno-543-cde-13-dioxolo-45-h-chromene-511-dione.webp&w=3840&q=75)
CAS 69251-99-6
:1,2,3-trimethoxychromeno[5,4,3-cde][1,3]dioxolo[4,5-h]chromene-5,11-dione
Description:
1,2,3-Trimethoxychromeno[5,4,3-cde][1,3]dioxolo[4,5-h]chromene-5,11-dione, with the CAS number 69251-99-6, is a complex organic compound belonging to the class of chromenes and dioxoles. This substance features a fused chromene structure, characterized by its aromatic rings and multiple methoxy groups, which contribute to its chemical reactivity and solubility properties. The presence of dione functional groups indicates that it can participate in various chemical reactions, including oxidation and reduction processes. Its methoxy substituents enhance its electron-donating ability, potentially influencing its biological activity and interactions with other molecules. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its structural complexity suggests potential applications in materials science and organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C18H12O9
InChI:InChI=1/C18H12O9/c1-21-12-10-9-8-6(17(19)26-14(9)16(23-3)15(12)22-2)4-7-11(25-5-24-7)13(8)27-18(10)20/h4H,5H2,1-3H3
SMILES:COc1c2c3c4c(cc5c(c4oc2=O)OCO5)c(=O)oc3c(c1OC)OC
Synonyms:- (1)Benzopyrano(5,4,3-cde)(1,3)dioxolo(4,5-h)(1)benzopyran-5,11-dione, 1,2,3-trimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2,3-Tri-O-methyl-7,8-methyleneflavellagic acid
CAS:1,2,3-Tri-O-methyl-7,8-methyleneflavellagic acid is a natural product for research related to life sciences.Formula:C18H12O9Purity:98%Color and Shape:SolidMolecular weight:372.281,2,3-Tri-O-methyl-7,8-methyleneflavellagic acid
CAS:Formula:C18H12O9Purity:95%~99%Molecular weight:372.2851,2,3-Tri-O-methyl-7,8-methyleneflavellagic acid
CAS:1,2,3-Tri-O-methyl-7,8-methyleneflavellagic acid is a synthetic derivative of ellagic acid, which is a polyphenolic compound primarily found in various fruits and nuts, including pomegranates, strawberries, and walnuts. This compound is structured through methylation and methylenation, enhancing its stability and solubility, which may modify its bioavailability and biological activity compared to its natural counterpart.Formula:C18H12O9Purity:Min. 95%Molecular weight:372.3 g/mol
