CAS 69257-51-8

1-Deoxy-1-nitro-L-glucitol

Description:

1-Deoxy-1-nitro-L-glucitol, with the CAS number 69257-51-8, is a chemical compound that belongs to the class of nitro sugars. It is characterized by the presence of a nitro group (-NO2) attached to the first carbon of the glucitol structure, which is a sugar alcohol derived from glucose. This modification imparts unique chemical properties, including potential reactivity and biological activity. The compound is typically a white to off-white solid and is soluble in water, which is a common characteristic of many sugar derivatives. Its structure allows it to participate in various chemical reactions, making it of interest in both synthetic organic chemistry and potential applications in biochemistry. Additionally, due to its structural similarity to glucose, it may interact with biological systems, although specific biological activities would require further investigation. Overall, 1-Deoxy-1-nitro-L-glucitol represents a fascinating example of how modifications to simple sugar structures can lead to compounds with diverse properties and potential applications.

Formula: C₆H₁₃NO₇

InChI: InChI=1S/C6H13NO7/c8-2-4(10)6(12)5(11)3(9)1-7(13)14/h3-6,8-12H,1-2H2/t3-,4+,5+,6+/m1/s1

InChI key: InChIKey=HOFCJTOUEGMYBT-VANKVMQKSA-N

SMILES: [C@@H]([C@H]([C@H](CO)O)O)([C@@H](CN(=O)=O)O)O

Synonyms:

• L-Glucitol, 1-deoxy-1-nitro-
• 1-Deoxy-1-nitro-L-glucitol

1-Deoxy-1-nitro-L-glucitol

CAS: 69257-51-8

1-Deoxy-1-nitro-L-glucitol is a potent apoptosis-inducing compound that has shown promising results in cancer research. It is an analog of vanillin and nintedanib, two well-known cancer cell inhibitors. 1-Deoxy-1-nitro-L-glucitol has been shown to inhibit the activity of several kinases, including those involved in tumor growth and progression. In addition, it has been found to be effective against various types of cancer cells, including Chinese hamster ovary cells and human bladder cancer cells. This compound also exhibits synergistic effects with other anti-cancer drugs such as glimepiride and apomorphine. The presence of 1-Deoxy-1-nitro-L-glucitol in urine may serve as a potential biomarker for the diagnosis and monitoring of certain cancers.

Formula: C₆H₁₃NO₇

Purity: Min. 95%

Molecular weight: 211.17 g/mol

Ref: 3D-MD183192