CymitQuimica logo

CAS 6926-09-6

:

Boc-Glycine hydrazide

Description:
Boc-Glycine hydrazide is a chemical compound characterized by its structure, which includes a Boc (tert-butyloxycarbonyl) protecting group attached to the amino acid glycine, linked to a hydrazide functional group. This compound is typically used in peptide synthesis and as an intermediate in organic synthesis due to its ability to protect amino groups during chemical reactions. The presence of the Boc group enhances the stability of the compound and facilitates selective reactions. Boc-Glycine hydrazide is generally a white to off-white solid and is soluble in polar organic solvents. Its reactivity is influenced by the hydrazide moiety, which can participate in various chemical transformations, including coupling reactions and hydrazone formation. Safety data indicates that, like many chemical substances, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact. Overall, Boc-Glycine hydrazide serves as a valuable building block in the synthesis of more complex molecules in medicinal chemistry and biochemistry.
Formula:C7H15N3O3
InChI:InChI=1/C7H15N3O3/c1-7(2,3)13-6(12)9-4-5(11)10-8/h4,8H2,1-3H3,(H,9,12)(H,10,11)
InChI key:MQBASTZLTYLEON-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCC(=NN)O)O
Synonyms:
  • Butoxycarbonylglycine hydrazide
  • Tert-Butyl (2-Hydrazino-2-Oxoethyl)Carbamate (Non-Preferred Name)
  • tert-butyl (2-hydrazinyl-2-oxoethyl)carbamate
Found 3 products.