CAS 6926-44-9
:(2-azidoethyl)benzene
Description:
(2-Azidoethyl)benzene, with the CAS number 6926-44-9, is an organic compound characterized by the presence of an azido group (-N3) attached to a benzene ring through an ethyl linker. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the azido functional group, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The azido group is also a potential source of nitrogen gas upon thermal decomposition, making (2-azidoethyl)benzene of interest in synthetic organic chemistry and materials science. Additionally, it may exhibit moderate to high toxicity, necessitating careful handling and storage. Its applications can range from use in organic synthesis to potential roles in the development of energetic materials. As with many azides, it is important to consider safety protocols due to the potential for explosive decomposition under certain conditions.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c9-11-10-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2
SMILES:c1ccc(cc1)CCN=[N+]=[NH-]
Synonyms:- 2-Phenylethyl azide
- Benzene, (2-Azidoethyl)-
- (2-Azidoethyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2-Azidoethyl)benzene
CAS:2-Azidoethylbenzene is a coumarin derivative that has been identified as an important bioactive molecule. It is synthesized by the reaction of azides and benzene using a reaction solution. The compound reacts with hydroxyl groups to form a C-N bond, which may be responsible for its biological activity. 2-Azidoethylbenzene has been shown to have anti-leukemia effects in radiation-sensitive leukemia cells. It also has vasodilatory properties that may be related to the increase in blood pressure induced by the compound. 2-Azidoethylbenzene has also been shown to be effective against hypoxia inducible factors such as HIF1α, which are proteins involved in cell growth and proliferation.
Formula:C8H9N3Purity:Min. 95%Molecular weight:147.18 g/mol
