CAS 6926-45-0
:Hexyl azide
Description:
Hexyl azide, with the CAS number 6926-45-0, is an organic compound characterized by its azide functional group (-N3) attached to a hexyl chain. It is a colorless to pale yellow liquid that is known for its high reactivity and potential explosiveness, particularly when subjected to heat or shock. Hexyl azide is typically used in organic synthesis and as a precursor in the preparation of various nitrogen-containing compounds. Its molecular formula is C6H14N3, and it has a relatively low boiling point compared to other azides, which contributes to its volatility. Due to the presence of the azide group, hexyl azide poses significant safety risks, necessitating careful handling and storage under controlled conditions to prevent accidental detonation. Additionally, it is important to note that hexyl azide is not widely used in commercial applications, primarily due to its hazardous nature. Proper safety protocols and risk assessments are essential when working with this compound in laboratory settings.
Formula:C6H13N3
InChI:InChI=1S/C6H13N3/c1-2-3-4-5-6-8-9-7/h2-6H2,1H3
InChI key:InChIKey=KFQRCGONYHVDKX-UHFFFAOYSA-N
SMILES:C(CCCC)CN=[N+]=[N-]
Synonyms:- Hexyl azide
- Hexane, 1-azido-
- 1-Azidohexane
- n-Hexyl azide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Azidohexane
CAS:1-Azidohexane is a nitro-containing molecule that can be used as a receptor binding agent. It binds to the dopamine receptor and has been shown to inhibit tumor growth in mice. 1-Azidohexane has been found to bind to the polymerase chain reaction (PCR) enzyme, which is an enzyme that replicates DNA as part of the process of DNA amplification. The hydroxyl group on the molecule reacts with azides to form cationic polymers that are able to cross membranes and enter cells, which then polymerize inside the cell. This process can be used for gene delivery or for DNA sequencing.Formula:C6H13N3Purity:Min. 95%Molecular weight:127.19 g/mol
