CAS 6926-84-7

2'-(methoxycarbonyl)biphenyl-2-carboxylic acid

Description:

2'-(Methoxycarbonyl)biphenyl-2-carboxylic acid, with the CAS number 6926-84-7, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two carboxylic acid functional groups: one at the 2-position of the biphenyl and another as a methoxycarbonyl group at the 2' position. The presence of these functional groups contributes to its acidity and potential reactivity in various chemical reactions, such as esterification or amidation. The methoxycarbonyl group enhances the compound's solubility in organic solvents and may influence its biological activity. Additionally, the compound may exhibit properties such as UV absorbance due to the conjugated system of the biphenyl structure. Its applications could range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its specific reactivity and interactions with other molecules. Overall, 2'-(methoxycarbonyl)biphenyl-2-carboxylic acid is a versatile compound with notable chemical characteristics.

Formula: C₁₅H₁₂O₄

InChI: InChI=1/C15H12O4/c1-19-15(18)13-9-5-3-7-11(13)10-6-2-4-8-12(10)14(16)17/h2-9H,1H3,(H,16,17)

SMILES: COC(=O)c1ccccc1c1ccccc1C(=O)O

2-[2-(Methoxycarbonyl)phenyl]benzoic acid

CAS: 6926-84-7

2-[2-(Methoxycarbonyl)phenyl]benzoic acid is a colorless crystalline compound that is soluble in water and insoluble in alcohol. It has a constant boiling point at 310°C, with a melting point of 186°C. 2-[2-(Methoxycarbonyl)phenyl]benzoic acid reacts with methyl alcohol and heat to produce methyl benzoate. The reaction rate increases with increasing concentrations of alkaline hydrolysis, monomethyl, and methyl alcohol. The product of the reaction is an anion that can be alkenyl or diphenic depending on the other reactants present. The parameters for this reaction are temperature, kinetics, alkaline hydrolysis, monomethyl, and isopropyl alcohol.

Formula: C₁₅H₁₂O₄

Purity: Min. 95%

Molecular weight: 256.25 g/mol

Ref: 3D-GAA92684