CymitQuimica logo

CAS 692732-82-4

:

N-(4-Acetylphenyl)-3,4-dihydro-2(1H)-isoquinolinecarboxamide

Description:
N-(4-Acetylphenyl)-3,4-dihydro-2(1H)-isoquinolinecarboxamide, with the CAS number 692732-82-4, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance typically exhibits a complex structure characterized by an isoquinoline core, which is fused with a dihydro moiety and substituted with an acetylphenyl group and a carboxamide functional group. The presence of these functional groups suggests potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, N-(4-Acetylphenyl)-3,4-dihydro-2(1H)-isoquinolinecarboxamide represents a unique scaffold for further research in drug development and pharmacology.
Formula:C18H18N2O2
InChI:InChI=1S/C18H18N2O2/c1-13(21)14-6-8-17(9-7-14)19-18(22)20-11-10-15-4-2-3-5-16(15)12-20/h2-9H,10-12H2,1H3,(H,19,22)
InChI key:InChIKey=SURYOOCJKPJCFJ-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(C)=O)C=C1)(=O)N2CC=3C(CC2)=CC=CC3
Synonyms:
  • 2(1H)-Isoquinolinecarboxamide, N-(4-acetylphenyl)-3,4-dihydro-
  • N-(4-Acetylphenyl)-3,4-dihydro-2(1H)-isoquinolinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.