CAS 692745-02-1

benzyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate

Description:

Benzyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group and a carboxylate functional group, contributing to its potential as a bioactive molecule. The presence of the benzyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The thiazole moiety is known for its role in various pharmacological activities, including antimicrobial and anticancer properties. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its reactivity and stability. Additionally, the methyl group at the 4-position of the thiazole ring may influence its electronic properties and steric hindrance, potentially impacting its biological activity. Overall, benzyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate is of interest in medicinal chemistry for its potential therapeutic applications.

Formula: C₁₂H₁₂N₂O₂S

InChI: InChI=1/C12H12N2O2S/c1-8-10(17-12(13)14-8)11(15)16-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,13,14)

SMILES: Cc1c(C(=O)OCc2ccccc2)sc(=N)[nH]1

Synonyms:

• 5-Thiazolecarboxylic Acid, 2-Amino-4-Methyl-, Phenylmethyl Ester

benzyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate

CAS: 692745-02-1

Formula: C₁₂H₁₂N₂O₂S

Purity: 95.0%

Molecular weight: 248.3

Ref: 10-F315705