CymitQuimica logo

CAS 69275-01-0

:

1,10-Bis(2-octyldodecyl) decanedioate

Description:
1,10-Bis(2-octyldodecyl) decanedioate, with the CAS number 69275-01-0, is an organic compound characterized by its long hydrocarbon chains and ester functional groups. This substance is a diester derived from decanedioic acid and 2-octyldodecanol, which contributes to its hydrophobic nature and potential applications in various fields, including materials science and polymer chemistry. The presence of multiple alkyl chains enhances its solubility in non-polar solvents and may impart favorable properties such as flexibility and thermal stability. Additionally, the compound's structure suggests it may exhibit low volatility and good thermal resistance, making it suitable for use in high-performance applications. Its unique molecular architecture can also influence its interactions with other materials, potentially enhancing compatibility in formulations. Overall, 1,10-Bis(2-octyldodecyl) decanedioate is notable for its potential utility in creating advanced materials, lubricants, or additives, although specific applications would depend on further research and development.
Formula:C50H98O4
InChI:InChI=1S/C50H98O4/c1-5-9-13-17-21-23-29-35-41-47(39-33-27-19-15-11-7-3)45-53-49(51)43-37-31-25-26-32-38-44-50(52)54-46-48(40-34-28-20-16-12-8-4)42-36-30-24-22-18-14-10-6-2/h47-48H,5-46H2,1-4H3
InChI key:InChIKey=VOKLGPGMRNGCOO-UHFFFAOYSA-N
SMILES:C(COC(CCCCCCCCC(OCC(CCCCCCCCCC)CCCCCCCC)=O)=O)(CCCCCCCCCC)CCCCCCCC
Synonyms:
  • Decanedioic acid, bis(2-octyldodecyl) ester
  • Decanedioic acid, 1,10-bis(2-octyldodecyl) ester
  • 1,10-Bis(2-octyldodecyl) decanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.