CAS 69301-27-5

5-methyl-2-(6-methylhept-5-en-2-yl)phenol

Description:

5-Methyl-2-(6-methylhept-5-en-2-yl)phenol, with the CAS number 69301-27-5, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a methyl group at the 5-position and a branched aliphatic chain at the 2-position of the phenol, contributing to its unique properties. The presence of the double bond in the aliphatic chain indicates potential for reactivity, particularly in addition reactions. This compound is likely to exhibit hydrophobic characteristics due to its hydrocarbon chain, while the hydroxyl group imparts some degree of polarity, allowing for hydrogen bonding. As a phenolic compound, it may possess antioxidant properties and could be of interest in various applications, including pharmaceuticals, agrochemicals, or as a chemical intermediate. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would need to be determined experimentally or sourced from chemical databases for precise applications.

Formula: C₁₅H₂₂O

InChI: InChI=1/C15H22O/c1-11(2)6-5-7-13(4)14-9-8-12(3)10-15(14)16/h6,8-10,13,16H,5,7H2,1-4H3

Synonyms:

• Phenol, 2-(1,5-dimethyl-4-hexenyl)-5-methyl-

Curcuphenol

CAS: 69301-27-5

Curcuphenol in concentrations in the range of 29-116 μg/ml inhibited cell proliferation and DNA replication and induced cell death in a dose-dependent manner.

Formula: C₁₅H₂₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.33

Ref: TM-T23919