CAS 69306-43-0

1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)methanamine

Description:

1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)methanamine, with the CAS number 69306-43-0, is a chemical compound characterized by its unique structure, which features a dibenzo[a,d]annulene framework. This structure consists of fused aromatic rings, contributing to its potential electronic and optical properties. The presence of the methanamine functional group indicates that the compound has an amine functionality, which can participate in hydrogen bonding and may influence its reactivity and solubility in various solvents. The compound is likely to exhibit interesting chemical behavior due to the conjugated system of the aromatic rings, which can affect its stability and interactions with other molecules. Additionally, the dihydro form suggests that it may have reduced aromaticity compared to fully aromatic compounds, potentially impacting its physical properties such as melting point and boiling point. Overall, this compound may have applications in organic synthesis, materials science, or as a precursor for further chemical modifications.

Formula: C₁₆H₁₇N

InChI: InChI=1/C16H17N/c17-11-16-14-7-3-1-5-12(14)9-10-13-6-2-4-8-15(13)16/h1-8,16H,9-11,17H2

SMILES: c1ccc2c(c1)CCc1ccccc1C2CN

Synonyms:

• 5H-Dibenzo[a,d]cycloheptene-5-methanamine, 10,11-dihydro-
• 1-(10,11-Dihydro-5H-dibenzo[a,d][7]annulen-5-yl)methanamine

5-Aminomethyl-dibenzosuberane

CAS: 69306-43-0

Purity: 97.0%

Color and Shape: Solid, White powder

Molecular weight: 223.31900024414062

Ref: 10-F011405