CAS 69306-89-4
:(3Z)-3-ethylidene-2-[1-(hydroxymethyl)-2-methoxy-2-oxoethyl]-5-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-5-ium (non-preferred name)
Description:
The chemical substance known as (3Z)-3-ethylidene-2-[1-(hydroxymethyl)-2-methoxy-2-oxoethyl]-5-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-5-ium, with the CAS number 69306-89-4, is a complex organic compound characterized by its unique structural features. It belongs to the class of indoloquinolizine derivatives, which are known for their potential biological activities. The presence of multiple functional groups, including a hydroxymethyl and a methoxy group, suggests that this compound may exhibit interesting reactivity and solubility properties. The octahydroindolo framework indicates a polycyclic structure that may contribute to its stability and potential interactions with biological targets. Additionally, the ethylidene and oxoethyl substituents may influence its pharmacological profile, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's intricate structure and functional diversity highlight its potential significance in various chemical and biological applications.
Formula:C22H29N2O3
InChI:InChI=1/C22H29N2O3/c1-4-14-12-24(2)10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-25)22(26)27-3/h4-8,17-18,20,23,25H,9-13H2,1-3H3/q+1/b14-4+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Diploceline
CAS:Diploceline is a medicinal compound that acts as an inhibitor of kinases, which are enzymes involved in the regulation of cellular processes. It has been shown to induce apoptosis, or programmed cell death, in cancer cells. Diploceline is an analog of a protein found in human urine and has demonstrated potent anticancer activity in Chinese hamster ovary cells. This compound is a promising candidate for the development of new cancer treatments due to its ability to selectively target cancer cells while leaving healthy cells unharmed. Its unique mechanism of action as a kinase inhibitor makes it a valuable addition to the arsenal of anticancer drugs available today.Formula:C22H29N2O3Purity:Min. 95%Molecular weight:369.5 g/mol

