CAS 6931-19-7
:5-Methoxyquinoline
Description:
5-Methoxyquinoline is an organic compound characterized by a quinoline structure with a methoxy group (-OCH₃) attached at the 5-position. It is a pale yellow to brownish solid that is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. This compound exhibits a range of interesting chemical properties, including the ability to participate in various electrophilic and nucleophilic reactions due to the presence of the nitrogen atom in the quinoline ring. 5-Methoxyquinoline is of interest in medicinal chemistry and research due to its potential biological activities, including antimicrobial and antitumor properties. Additionally, it can serve as a building block in the synthesis of more complex molecules. Its molecular formula is C₉H₉N O, and it has a relatively stable structure, making it suitable for various applications in organic synthesis and pharmaceutical development. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C10H9NO
InChI:InChI=1/C10H9NO/c1-12-10-6-2-5-9-8(10)4-3-7-11-9/h2-7H,1H3
SMILES:COc1cccc2c1cccn2
Synonyms:- Quinoline, 5-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Methoxyquinoline
CAS:5-MethoxyquinolineFormula:C10H9NOPurity:97%Color and Shape: colourless to light yellow liquidMolecular weight:159.18g/mol5-Methoxyquinoline
CAS:5-Methoxyquinoline (5MQ) is a chemical compound that belongs to the quinoline derivatives. It has shown anticancer activity in tumor models through a proton-transfer mechanism. 5MQ reacts with an acidic proton, such as the hydronium ion, to produce a reactive intermediate that can react with DNA and other cellular macromolecules. The drug also has been shown to inhibit the growth of bacteria by inhibiting protein synthesis. This inhibition is due to its ability to transfer protons from one molecule to another, which alters the charge distribution on that molecule and prevents it from reacting with other molecules.Formula:C10H9NOPurity:Min. 95%Color and Shape:LiquidMolecular weight:159.18 g/mol




