CAS 69316-08-1

methyl 4-(cyanoacetyl)benzoate

Description:

Methyl 4-(cyanoacetyl)benzoate, with the CAS number 69316-08-1, is an organic compound that features a benzoate structure with a cyanoacetyl group attached to the para position of the aromatic ring. This compound is characterized by its ester functional group, which contributes to its reactivity and solubility properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both the cyano and acetyl groups enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, methyl 4-(cyanoacetyl)benzoate may exhibit biological activity, which can be explored in medicinal chemistry. Its stability and reactivity can be influenced by factors such as temperature and solvent choice, making it important to consider these conditions during handling and experimentation.

Formula: C₁₁H₉NO₃

InChI: InChI=1/C11H9NO3/c1-15-11(14)9-4-2-8(3-5-9)10(13)6-7-12/h2-5H,6H2,1H3

SMILES: COC(=O)c1ccc(cc1)C(=O)CC#N

Synonyms:

• Benzoic Acid, 4-(2-Cyanoacetyl)-, Methyl Ester
• Methyl-4-(cyanacetyl)benzolcarboxylat
• Methyl 4-(2-Cyanoacetyl)Benzoate

Methyl 4-(cyanoacetyl)benzoate

CAS: 69316-08-1

Formula: C₁₁H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.1941

Ref: IN-DA003RTW

Methyl 4-(cyanoacetyl)benzoate

CAS: 69316-08-1

Methyl 4-(cyanoacetyl)benzoate

Purity: 96%

Molecular weight: 203.19g/mol

Ref: 54-OR322117

Methyl 4-(cyanoacetyl)benzoate

CAS: 69316-08-1

Formula: C₁₁H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.197

Ref: 10-F223865