
CAS 69319-47-7
:2-Propanol, 1-(2-bicyclo[2.2.1]hept-2-ylphenoxy)-3-[(1-methylethyl)amino]-, hydrochloride (1:1)
Description:
2-Propanol, 1-(2-bicyclo[2.2.1]hept-2-ylphenoxy)-3-[(1-methylethyl)amino]-, hydrochloride (1:1), with CAS number 69319-47-7, is a chemical compound characterized by its complex structure, which includes a bicyclic system and an isopropanol moiety. This compound features a bicyclo[2.2.1]heptane ring, which contributes to its unique three-dimensional shape, potentially influencing its biological activity and interactions. The presence of a phenoxy group enhances its solubility and reactivity, while the isopropylamino group may impart specific pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific interactions and the presence of functional groups. Overall, this compound's structural complexity suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C19H29NO2·ClH
InChI:InChI=1S/C19H29NO2.ClH/c1-13(2)20-11-16(21)12-22-19-6-4-3-5-17(19)18-10-14-7-8-15(18)9-14;/h3-6,13-16,18,20-21H,7-12H2,1-2H3;1H
InChI key:InChIKey=FTPYPDLGVVMWFU-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)C)O)C1=C(C2C3CC(C2)CC3)C=CC=C1.Cl
Synonyms:- 2-Propanol, 1-(2-bicyclo[2.2.1]hept-2-ylphenoxy)-3-[(1-methylethyl)amino]-, hydrochloride
- 2-Propanol, 1-(2-bicyclo[2.2.1]hept-2-ylphenoxy)-3-[(1-methylethyl)amino]-, hydrochloride (1:1)
- Bornaprolol hydrochloride
- FM 24
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FM-24 HCl
CAS:FM-24 HCl is a long acting beta-adrenergic receptor antagonist.Formula:C19H30ClNO2Color and Shape:SolidMolecular weight:339.9
