CymitQuimica logo

CAS 69321-18-2

:

{3-[(E)-(4-aminophenyl)diazenyl]phenyl}methanol

Description:
The chemical substance known as {3-[(E)-(4-aminophenyl)diazenyl]phenyl}methanol, with the CAS number 69321-18-2, is an organic compound characterized by its azo group, which is a functional group containing a nitrogen-nitrogen double bond (–N=N–). This compound features a phenolic structure, indicating the presence of a hydroxyl group (–OH) attached to a benzene ring, which contributes to its reactivity and potential applications in dye chemistry. The presence of the amino group (–NH2) on one of the phenyl rings enhances its solubility in polar solvents and may influence its biological activity. The compound's azo linkage can impart color, making it relevant in dye and pigment applications. Additionally, the structural configuration suggests potential for various interactions, including hydrogen bonding and π-π stacking, which may affect its stability and reactivity. Overall, this compound's unique structural features position it as a candidate for further research in fields such as materials science, organic synthesis, and medicinal chemistry.
Formula:C13H13N3O
InChI:InChI=1/C13H13N3O/c14-11-4-6-12(7-5-11)15-16-13-3-1-2-10(8-13)9-17/h1-8,17H,9,14H2/b16-15+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.