CymitQuimica logo

CAS 69321-95-5

:

5-hydroxy-1-pentofuranosylpyrimidine-2,4(1H,3H)-dione

Description:
5-Hydroxy-1-pentofuranosylpyrimidine-2,4(1H,3H)-dione, with the CAS number 69321-95-5, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a hydroxyl group and a furanosyl moiety, indicating its potential role in biological systems, particularly in nucleic acid metabolism. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. As a pyrimidine derivative, it may exhibit properties relevant to nucleoside analogs, which can be significant in medicinal chemistry and drug development. The compound's structure implies potential interactions with enzymes or receptors involved in nucleic acid synthesis or repair. Its stability, solubility, and biological activity would depend on various factors, including pH and the presence of other ions or molecules in the environment. Overall, this compound may have applications in research related to biochemistry and pharmacology, particularly in the study of nucleosides and their analogs.
Formula:C9H12N2O7
InChI:InChI=1/C9H12N2O7/c12-2-4-5(14)6(15)8(18-4)11-1-3(13)7(16)10-9(11)17/h1,4-6,8,12-15H,2H2,(H,10,16,17)
SMILES:c1c(c(nc(=O)n1C1C(C(C(CO)O1)O)O)O)O
Synonyms:
  • 1-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-5-hydroxypyrimidine-2,4(1H,3H)-dione
  • 2(1H)-pyrimidinone, 4,5-dihydroxy-1-pentofuranosyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.