CAS 6933-00-2
:2-chloro-N-ethyl-N-(2-methylphenyl)acetamide
Description:
2-Chloro-N-ethyl-N-(2-methylphenyl)acetamide, with the CAS number 6933-00-2, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent on the second carbon of the acetamide structure, along with an ethyl group and a 2-methylphenyl group attached to the nitrogen atom. The presence of the chlorine atom contributes to its reactivity and potential applications in various chemical reactions. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic ring and polar amide group. Its molecular structure suggests potential uses in pharmaceuticals or agrochemicals, where the specific substitution pattern may influence biological activity. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, 2-chloro-N-ethyl-N-(2-methylphenyl)acetamide represents a unique structure within the realm of organic chemistry, with properties that may be explored for various applications.
Formula:C11H14ClNO
InChI:InChI=1/C11H14ClNO/c1-3-13(11(14)8-12)10-7-5-4-6-9(10)2/h4-7H,3,8H2,1-2H3
SMILES:CCN(c1ccccc1C)C(=O)CCl
Synonyms:- Acetamide, 2-chloro-N-ethyl-N-(2-methylphenyl)-
- 2-CHLORO-N-ETHYL-N-(2-METHYLPHENYL)ACETAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.