CAS 6933-47-7
:4-Amino-2-methylbenzoic acid methyl ester
Description:
4-Amino-2-methylbenzoic acid methyl ester, also known as methyl 4-amino-2-methylbenzoate, is an organic compound characterized by its aromatic structure, which includes an amino group and a methyl ester functional group. This compound typically appears as a white to off-white crystalline solid. It is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water due to its hydrophobic aromatic ring. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Its reactivity and functional groups make it a valuable building block in the development of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-6-5-7(10)3-4-8(6)9(11)12-2/h3-5H,10H2,1-2H3
SMILES:Cc1cc(ccc1C(=O)OC)N
Synonyms:- Benzoic acid, 4-amino-2-methyl-, methyl ester
- Methyl 4-amino-2-methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-amino-2-methyl-, methyl ester
CAS:Formula:C9H11NO2Purity:98%Color and Shape:SolidMolecular weight:165.1891Methyl 4-amino-2-methylbenzoate
CAS:Methyl 4-amino-2-methylbenzoateFormula:C9H11NO2Purity:98%Color and Shape: off-white to light brown solidMolecular weight:165.19g/molMethyl 4-amino-2-methyl benzoate
CAS:Methyl 4-amino-2-methyl benzoate is a fine chemical that can be used as a building block for research chemicals, pharmaceuticals, and speciality chemicals. Methyl 4-amino-2-methyl benzoate is a versatile building block in organic synthesis because it can be used as a reaction component and intermediate to synthesize other compounds. This compound is also an excellent scaffold for the synthesis of complex compounds, making it a useful intermediate for organic chemistry. Methyl 4-amino-2-methyl benzoate has CAS No. 6933-47-7 and is soluble in organic solvents such as dichloromethane, chloroform, ether, or acetone.Formula:C9H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:165.19 g/molMethyl 4-amino-2-methylbenzoate
CAS:Formula:C9H11NO2Purity:97%Color and Shape:SolidMolecular weight:165.192



