CAS 69337-31-1

6-chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

Description:

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which incorporates both carbonyl and cyano functional groups. The presence of the chloro substituent and the dimethyl groups contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may display varying degrees of stability depending on environmental conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can participate in chemical reactions. Additionally, the compound may exhibit interesting optical properties and could be explored for its role in organic synthesis or as a building block in more complex molecular architectures. As with many heterocycles, its reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest in both theoretical and applied chemistry.

Formula: C₇H₆ClN₃O₂

InChI: InChI=1/C7H6ClN3O2/c1-10-5(8)4(3-9)6(12)11(2)7(10)13/h1-2H3

SMILES: Cn1c(c(C#N)c(=O)n(C)c1=O)Cl

Synonyms:

• 5-Pyrimidinecarbonitrile, 6-chloro-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

CAS: 69337-31-1

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

Purity: 95%

Molecular weight: 199.59g/mol

Ref: 54-OR83397

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

CAS: 69337-31-1

Purity: 97%

Molecular weight: 199.58999633789062

Ref: 10-F657715

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

CAS: 69337-31-1

6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is a specific inhibitor of the IκB kinase (IKK). It has been shown to be effective against many inflammatory diseases in experimental models. 6CdmTHPC inhibits the expression of cytokine genes by preventing phosphorylation of IκBα and translocation. 6CdmTHPC also prevents the formation of complexes with transcription factors that regulate gene expression. This drug has high potency and may be repurposed for treatment of inflammatory diseases.

Formula: C₇H₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 199.59 g/mol

Ref: 3D-UCA33731