CAS 6934-03-8
:3-(1,1-Dimethylethyl)-2-hydroxy-6-methylbenzoic acid
Description:
3-(1,1-Dimethylethyl)-2-hydroxy-6-methylbenzoic acid, commonly known as a derivative of benzoic acid, is characterized by its aromatic structure featuring a hydroxyl group and a carboxylic acid functional group. This compound exhibits properties typical of phenolic acids, including potential antioxidant activity due to the presence of the hydroxyl group. The bulky tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, which may influence its solubility and reactivity in various environments. The methyl group at the 6-position contributes to steric hindrance, potentially affecting its interaction with biological systems. This compound may be utilized in various applications, including as a chemical intermediate in organic synthesis or as a potential additive in formulations. Its CAS number, 6934-03-8, allows for precise identification in chemical databases. Overall, the unique structural features of this compound suggest it may possess interesting chemical and biological properties worthy of further investigation.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-7-5-6-8(12(2,3)4)10(13)9(7)11(14)15/h5-6,13H,1-4H3,(H,14,15)
InChI key:InChIKey=JXQCUCDXLSGQNZ-UHFFFAOYSA-N
SMILES:OC1=C(C(O)=O)C(C)=CC=C1C(C)(C)C
Synonyms:- 2,6-Cresotic acid, 3-tert-butyl-
- 3-(1,1-Dimethylethyl)-2-hydroxy-6-methylbenzoic acid
- 3-tert-Butyl-6-methylsalicylic acid
- Benzoic Acid, 3-(1,1-Dimethylethyl)-2-Hydroxy-6-Methyl-
- 3-tert-Butyl-2-hydroxy-6-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-tert-Butyl-6-methylsalicylic acid
CAS:3-tert-Butyl-6-methylsalicylic acid is a versatile building block that is used in the synthesis of complex compounds. It reacts with amines to form salicylanilides and is also used as a reagent for the synthesis of acetylenes. 3-tert-Butyl-6-methylsalicylic acid can be used as a starting material for the production of pharmaceuticals, pesticides, and dyes. This compound has been shown to be an effective intermediate in the synthesis of new drugs, such as antimalarial agents and analgesics. The high quality of this chemical makes it a useful scaffold for organic synthesis.Formula:C12H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:208.25 g/mol
