CAS 69342-45-6
:1-Isocyanato-4-(1-methylethoxy)benzene
Description:
1-Isocyanato-4-(1-methylethoxy)benzene, also known by its CAS number 69342-45-6, is an organic compound characterized by the presence of an isocyanate functional group attached to a substituted benzene ring. This compound features a methylethoxy group, which contributes to its unique chemical properties. Typically, isocyanates are reactive species that can participate in various chemical reactions, including nucleophilic addition and polymerization, making them important in the production of polyurethanes and other polymers. The presence of the methylethoxy group can influence the compound's solubility, reactivity, and overall stability. In terms of safety, isocyanates are known to be hazardous, often causing respiratory irritation and sensitization, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. Overall, 1-Isocyanato-4-(1-methylethoxy)benzene is a valuable compound in organic synthesis and materials science, with applications in coatings, adhesives, and foams.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-8(2)13-10-5-3-9(4-6-10)11-7-12/h3-6,8H,1-2H3
InChI key:InChIKey=GLBWCIOPSWMAFY-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC=C(N=C=O)C=C1
Synonyms:- 1-Isocyanato-4-(1-methylethoxy)benzene
- 4-(1-Methylethoxy)phenyl isocyanate
- 4-Isopropoxyphenyl isocyanate
- Benzene, 1-isocyanato-4-(1-methylethoxy)-
- 1-Isocyanato-4-(propan-2-yloxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.