CAS 6935-99-5

dimethyl (4-methylbenzene-1,3-diyl)biscarbamate

Description:

Dimethyl (4-methylbenzene-1,3-diyl)biscarbamate, with the CAS number 6935-99-5, is an organic compound characterized by its structure, which features two carbamate functional groups attached to a 4-methylbenzene-1,3-diyl moiety. This compound typically appears as a solid or viscous liquid, depending on the specific conditions. It is known for its applications in various fields, including agriculture as a pesticide or herbicide, due to its ability to inhibit certain biological processes in target organisms. The presence of the carbamate groups contributes to its reactivity and potential for forming hydrogen bonds, influencing its solubility and interaction with other substances. Additionally, the methyl groups on the aromatic ring can affect the compound's stability and reactivity. Safety considerations are important, as carbamates can exhibit toxicity to non-target organisms, necessitating careful handling and usage in accordance with regulatory guidelines. Overall, dimethyl (4-methylbenzene-1,3-diyl)biscarbamate is a notable compound in the realm of synthetic organic chemistry and agrochemicals.

Formula: C₁₁H₁₄N₂O₄

InChI: InChI=1/C11H14N2O4/c1-7-4-5-8(12-10(14)16-2)6-9(7)13-11(15)17-3/h4-6H,1-3H3,(H,12,14)(H,13,15)

SMILES: Cc1ccc(cc1N=C(O)OC)N=C(O)OC

Obtucarbamate A

CAS: 6935-99-5

Formula: C₁₁H₁₄N₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 238.2399

Ref: IN-DA005N97

Obtucarbamate A

CAS: 6935-99-5

Formula: C₁₁H₁₄N₂O₄

Molecular weight: 238.24

Ref: 7W-GY0918

Obtucarbamate A

CAS: 6935-99-5

Obtucarbamate A

Purity: ≥98%

Molecular weight: 238.24g/mol

Ref: 54-BUP05867

Obtucarbamate A

CAS: 6935-99-5

Formula: C₁₁H₁₄N₂O₄

Purity: 95%~99%

Molecular weight: 238.243

Ref: BP-SBP02741

Obtucarbamate A

CAS: 6935-99-5

Obtucarbamate A isolated from Disporum cantoniense has antitussive activity.It has antitussive activity, it exhibits significant inhibitory effect against

Formula: C₁₁H₁₄N₂O₄

Purity: 99.4% - 99.97%

Color and Shape: Solid

Molecular weight: 238.24

Ref: TM-TN2003

Obtucarbamate A

CAS: 6935-99-5

Obtucarbamate A is a selective herbicide of synthetic origin, designed to target specific unwanted plant species. It is derived through complex chemical synthesis processes, resulting in a compound that effectively interferes with crucial plant metabolic pathways. The mode of action of Obtucarbamate A involves the inhibition of acetolactate synthase (ALS), an enzyme integral to the biosynthesis of branched-chain amino acids in plants, thereby impeding their growth and survival.

Formula: C₁₁H₁₄N₂O₄

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-GAA93599