CAS 69353-21-5: galanthamine hydrobromide

Description:Galanthamine hydrobromide is a chemical compound that serves primarily as a reversible inhibitor of the enzyme acetylcholinesterase, which plays a crucial role in the breakdown of the neurotransmitter acetylcholine. This property makes galanthamine hydrobromide valuable in the treatment of Alzheimer's disease and other cognitive disorders, as it can enhance cholinergic function in the brain. The compound is typically presented as a white to off-white crystalline powder and is soluble in water, which facilitates its administration in pharmaceutical formulations. Galanthamine itself is derived from various plant sources, particularly the snowdrop flower (Galanthus nivalis). In addition to its cognitive-enhancing effects, galanthamine has been studied for its potential neuroprotective properties and its ability to modulate nicotinic acetylcholine receptors. Safety and efficacy profiles are well-documented, but like all medications, it may have side effects and contraindications that should be considered in clinical use. Overall, galanthamine hydrobromide represents an important therapeutic agent in neurology and geriatric medicine.

Formula:C₁₇H₂₂NO₃Br

InChI:InChI=1/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/p+1/t12-,14-,17-/m0/s1

Synonyms:
Galantamine Hydrobromide
Galantamine Hbr
Galanthamine Hydrobromide (1:1)
(4aS,6R,8aS)-6-hydroxy-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-11-ium
Galanthamine HBr
5A,6,7,8,8A,12B-Hexahydrogalanthamine Hydrobromide (1:1)