CAS 69359-04-2

4-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenol

Description:

4-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenol, with the CAS number 69359-04-2, is a chemical compound characterized by its complex structure, which includes an imidazo-thiazole moiety and a phenolic group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the phenolic hydroxyl group may impart antioxidant properties, while the imidazo-thiazole structure is often linked to various pharmacological activities, including antimicrobial and anti-inflammatory effects. The stereochemistry indicated by the (6S) designation suggests specific spatial arrangements that can influence the compound's reactivity and interaction with biological targets. As a result, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.

Formula: C₁₁H₁₂N₂OS

InChI: InChI=1/C11H12N2OS/c14-9-3-1-8(2-4-9)10-7-13-5-6-15-11(13)12-10/h1-4,10,14H,5-7H2/t10-/m1/s1

SMILES: c1cc(ccc1[C@H]1CN2CCSC2=N1)O

Synonyms:

• Phenol, 4-(2,3,5,6-tetrahydroimidazo(2,1-b)thiazol-6-yl)-, (S)-

4-Hydroxy Levamisole

CAS: 69359-04-2

Formula: C₁₁H₁₂N₂OS

Ref: TR-TRC-H943720

4-Hydroxy Levamisole

Controlled Product

CAS: 69359-04-2

Formula: C₁₁H₁₂N₂OS

Color and Shape: Neat

Molecular weight: 220.29

Ref: TR-H943720