CAS 69369-16-0
:2,6-diaminopurine hemisulfate
Description:
2,6-Diaminopurine hemisulfate is a purine derivative that serves as a nucleobase analog, primarily used in biochemical research and as a potential therapeutic agent. It is characterized by the presence of two amino groups at the 2 and 6 positions of the purine ring, which enhances its biological activity. The substance is typically encountered as a white to off-white crystalline powder, soluble in water, which facilitates its use in various aqueous biological assays. As a nucleobase analog, it can interfere with nucleic acid synthesis and has been studied for its potential applications in antiviral and anticancer therapies. The hemisulfate salt form indicates that it is combined with sulfuric acid, which can influence its solubility and stability. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, 2,6-diaminopurine hemisulfate is a significant compound in the field of molecular biology and pharmacology, contributing to the understanding of nucleic acid interactions and cellular processes.
Formula:C10H14N12O4S
InChI:InChI=1/2C5H6N6.H2O4S/c2*6-3-2-4(9-1-8-2)11-5(7)10-3;1-5(2,3)4/h2*1H,(H5,6,7,8,9,10,11);(H2,1,2,3,4)
SMILES:c1nc2c(N)[nH]c(=N)[nH]c2n1.c1nc2c(N)[nH]c(=N)[nH]c2n1.OS(=O)(=O)O
Synonyms:- 2,6-Diaminopurine Hemisulfate Salt
- 7H-purine-2,6-diamine sulfate (2:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Diaminopurine hemisulfate
CAS:<p>2,6-Diaminopurine hemisulfate salt is a fine chemical that can be used as a building block for research chemicals, reagents, and specialty chemicals. It has been shown to be useful in the synthesis of various types of complex compounds. 2,6-Diaminopurine hemisulfate salt is also versatile in the sense that it can be used as an intermediate in reactions or as a scaffold for chemical synthesis. This product has CAS number 69369-16-0.</p>Formula:C5H6N6•(H2O4S)0Purity:Min. 95%Color and Shape:PowderMolecular weight:398.36 g/mol2,6-Diaminopurine Hemisulfate
CAS:Controlled Product<p>Impurity Abacavir Diamino Purine Impurity<br>Applications 2,6-Diaminopurine is an antagonist of naturally occurring purines.<br>References Ikawa, M., et al.: J. Agric. Food Chem., 36, 309 (1988),<br></p>Formula:C5H6N6·H2O4SColor and Shape:NeatMolecular weight:398.36


